C20H25N3 — CID 168530631
(1-benzyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylidenehydrazine (PubChem CID 168530631) has the molecular formula C20H25N3 and a molecular weight of 307.44 g/mol. Its IUPAC name is (1-benzyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylidenehydrazine.
| Compound Name | (1-benzyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylidenehydrazine |
|---|---|
| PubChem CID | 168530631 |
| Molecular Formula | C20H25N3 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | (1-benzyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylidenehydrazine |
| SMILES | CC1CC(C)(C)N(Cc2ccccc2)c2ccc(C=NN)cc21 |
| InChI | InChI=1S/C20H25N3/c1-15-12-20(2,3)23(14-16-7-5-4-6-8-16)19-10-9-17(13-22-21)11-18(15)19/h4-11,13,15H,12,14,21H2,1-3H3 |
| InChIKey | PREILJNJMCXICY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|