C9H12ClN3 — CID 168531233
3-chloro-4-methanehydrazonoyl-N,N-dimethylaniline (PubChem CID 168531233) has the molecular formula C9H12ClN3 and a molecular weight of 197.67 g/mol. Its IUPAC name is 3-chloro-4-methanehydrazonoyl-N,N-dimethylaniline.
| Compound Name | 3-chloro-4-methanehydrazonoyl-N,N-dimethylaniline |
|---|---|
| PubChem CID | 168531233 |
| Molecular Formula | C9H12ClN3 |
| Molecular Weight | 197.67 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 3-chloro-4-methanehydrazonoyl-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C=NN)c(Cl)c1 |
| InChI | InChI=1S/C9H12ClN3/c1-13(2)8-4-3-7(6-12-11)9(10)5-8/h3-6H,11H2,1-2H3 |
| InChIKey | IHROKVAROMXVTA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.67 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|