C14H17N5O2 — CID 168533869
[[4-(5-butyl-1,3,4-oxadiazol-2-yl)phenyl]methylideneamino]urea (PubChem CID 168533869) has the molecular formula C14H17N5O2 and a molecular weight of 287.32 g/mol. Its IUPAC name is [[4-(5-butyl-1,3,4-oxadiazol-2-yl)phenyl]methylideneamino]urea.
| Compound Name | [[4-(5-butyl-1,3,4-oxadiazol-2-yl)phenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 168533869 |
| Molecular Formula | C14H17N5O2 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | [[4-(5-butyl-1,3,4-oxadiazol-2-yl)phenyl]methylideneamino]urea |
| SMILES | CCCCc1nnc(-c2ccc(C=NNC(N)=O)cc2)o1 |
| InChI | InChI=1S/C14H17N5O2/c1-2-3-4-12-17-18-13(21-12)11-7-5-10(6-8-11)9-16-19-14(15)20/h5-9H,2-4H2,1H3,(H3,15,19,20) |
| InChIKey | DNECQRSCSVVCSA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 106.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|