C21H17NO5 — CID 168538340
2,2-dimethyl-5-[[(2-phenyl-1-benzofuran-5-yl)amino]methylidene]-1,3-dioxane-4,6-dione (PubChem CID 168538340) has the molecular formula C21H17NO5 and a molecular weight of 363.37 g/mol. Its IUPAC name is 2,2-dimethyl-5-[[(2-phenyl-1-benzofuran-5-yl)amino]methylidene]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[[(2-phenyl-1-benzofuran-5-yl)amino]methylidene]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 168538340 |
| Molecular Formula | C21H17NO5 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 2,2-dimethyl-5-[[(2-phenyl-1-benzofuran-5-yl)amino]methylidene]-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=CNc2ccc3oc(-c4ccccc4)cc3c2)C(=O)O1 |
| InChI | InChI=1S/C21H17NO5/c1-21(2)26-19(23)16(20(24)27-21)12-22-15-8-9-17-14(10-15)11-18(25-17)13-6-4-3-5-7-13/h3-12,22H,1-2H3 |
| InChIKey | LUEOKFNVJILFDL-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|