C24H18N4O6 — CID 168539808
2,2-dimethyl-5-[[[2-oxo-3-(3-phenyl-1,2,4-triazol-1-yl)chromen-7-yl]amino]methylidene]-1,3-dioxane-4,6-dione (PubChem CID 168539808) has the molecular formula C24H18N4O6 and a molecular weight of 458.43 g/mol. Its IUPAC name is 2,2-dimethyl-5-[[[2-oxo-3-(3-phenyl-1,2,4-triazol-1-yl)chromen-7-yl]amino]methylidene]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[[[2-oxo-3-(3-phenyl-1,2,4-triazol-1-yl)chromen-7-yl]amino]methylidene]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 168539808 |
| Molecular Formula | C24H18N4O6 |
| Molecular Weight | 458.43 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 2,2-dimethyl-5-[[[2-oxo-3-(3-phenyl-1,2,4-triazol-1-yl)chromen-7-yl]amino]methylidene]-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=CNc2ccc3cc(-n4cnc(-c5ccccc5)n4)c(=O)oc3c2)C(=O)O1 |
| InChI | InChI=1S/C24H18N4O6/c1-24(2)33-21(29)17(22(30)34-24)12-25-16-9-8-15-10-18(23(31)32-19(15)11-16)28-13-26-20(27-28)14-6-4-3-5-7-14/h3-13,25H,1-2H3 |
| InChIKey | OGXWJRUJZNXZML-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|