C18H13N5O2S — CID 169358901
[2-oxo-3-(3-phenyl-1,2,4-triazol-1-yl)chromen-7-yl]thiourea (PubChem CID 169358901) has the molecular formula C18H13N5O2S and a molecular weight of 363.40 g/mol. Its IUPAC name is [2-oxo-3-(3-phenyl-1,2,4-triazol-1-yl)chromen-7-yl]thiourea.
| Compound Name | [2-oxo-3-(3-phenyl-1,2,4-triazol-1-yl)chromen-7-yl]thiourea |
|---|---|
| PubChem CID | 169358901 |
| Molecular Formula | C18H13N5O2S |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | [2-oxo-3-(3-phenyl-1,2,4-triazol-1-yl)chromen-7-yl]thiourea |
| SMILES | NC(=S)Nc1ccc2cc(-n3cnc(-c4ccccc4)n3)c(=O)oc2c1 |
| InChI | InChI=1S/C18H13N5O2S/c19-18(26)21-13-7-6-12-8-14(17(24)25-15(12)9-13)23-10-20-16(22-23)11-4-2-1-3-5-11/h1-10H,(H3,19,21,26) |
| InChIKey | IZCDAIYMUUXVAK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 98.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|