C24H22N2O4S — CID 168539824
5-[[3-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]anilino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 168539824) has the molecular formula C24H22N2O4S and a molecular weight of 434.52 g/mol. Its IUPAC name is 5-[[3-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]anilino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[[3-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]anilino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 168539824 |
| Molecular Formula | C24H22N2O4S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 5-[[3-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]anilino]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | Cc1ccc(C)c(-c2csc(-c3cccc(NC=C4C(=O)OC(C)(C)OC4=O)c3)n2)c1 |
| InChI | InChI=1S/C24H22N2O4S/c1-14-8-9-15(2)18(10-14)20-13-31-21(26-20)16-6-5-7-17(11-16)25-12-19-22(27)29-24(3,4)30-23(19)28/h5-13,25H,1-4H3 |
| InChIKey | ONKGLUNTXFRJTB-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|