C24H22N4O4 — CID 168541135
2,2-dimethyl-5-[[3-[4-(2-methylanilino)pyrimidin-2-yl]anilino]methylidene]-1,3-dioxane-4,6-dione (PubChem CID 168541135) has the molecular formula C24H22N4O4 and a molecular weight of 430.46 g/mol. Its IUPAC name is 2,2-dimethyl-5-[[3-[4-(2-methylanilino)pyrimidin-2-yl]anilino]methylidene]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[[3-[4-(2-methylanilino)pyrimidin-2-yl]anilino]methylidene]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 168541135 |
| Molecular Formula | C24H22N4O4 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 2,2-dimethyl-5-[[3-[4-(2-methylanilino)pyrimidin-2-yl]anilino]methylidene]-1,3-dioxane-4,6-dione |
| SMILES | Cc1ccccc1Nc1ccnc(-c2cccc(NC=C3C(=O)OC(C)(C)OC3=O)c2)n1 |
| InChI | InChI=1S/C24H22N4O4/c1-15-7-4-5-10-19(15)27-20-11-12-25-21(28-20)16-8-6-9-17(13-16)26-14-18-22(29)31-24(2,3)32-23(18)30/h4-14,26H,1-3H3,(H,25,27,28) |
| InChIKey | KFPMDRKGRAEVIV-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|