C19H18ClN5 — CID 169369823
2-chloro-N'-[3-[4-(2-methylanilino)pyrimidin-2-yl]phenyl]ethanimidamide (PubChem CID 169369823) has the molecular formula C19H18ClN5 and a molecular weight of 351.84 g/mol. Its IUPAC name is 2-chloro-N'-[3-[4-(2-methylanilino)pyrimidin-2-yl]phenyl]ethanimidamide.
| Compound Name | 2-chloro-N'-[3-[4-(2-methylanilino)pyrimidin-2-yl]phenyl]ethanimidamide |
|---|---|
| PubChem CID | 169369823 |
| Molecular Formula | C19H18ClN5 |
| Molecular Weight | 351.84 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 2-chloro-N'-[3-[4-(2-methylanilino)pyrimidin-2-yl]phenyl]ethanimidamide |
| SMILES | Cc1ccccc1Nc1ccnc(-c2cccc(/N=C(/N)CCl)c2)n1 |
| InChI | InChI=1S/C19H18ClN5/c1-13-5-2-3-8-16(13)24-18-9-10-22-19(25-18)14-6-4-7-15(11-14)23-17(21)12-20/h2-11H,12H2,1H3,(H2,21,23)(H,22,24,25) |
| InChIKey | RTGKRYGIFPYVHX-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.84 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|