C23H24N2O7 — CID 168540279
N-[(3,4-dimethoxyphenyl)methyl]-2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]benzamide (PubChem CID 168540279) has the molecular formula C23H24N2O7 and a molecular weight of 440.45 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]benzamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]benzamide |
|---|---|
| PubChem CID | 168540279 |
| Molecular Formula | C23H24N2O7 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]benzamide |
| SMILES | COc1ccc(CNC(=O)c2ccccc2NC=C2C(=O)OC(C)(C)OC2=O)cc1OC |
| InChI | InChI=1S/C23H24N2O7/c1-23(2)31-21(27)16(22(28)32-23)13-24-17-8-6-5-7-15(17)20(26)25-12-14-9-10-18(29-3)19(11-14)30-4/h5-11,13,24H,12H2,1-4H3,(H,25,26) |
| InChIKey | ARMKQMDLUISTTP-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|