C14H9N5O3 — CID 168544113
1-[3-(2,2-dicyanoethenylamino)phenyl]-5-oxo-4H-pyrazole-3-carboxylic acid (PubChem CID 168544113) has the molecular formula C14H9N5O3 and a molecular weight of 295.26 g/mol. Its IUPAC name is 1-[3-(2,2-dicyanoethenylamino)phenyl]-5-oxo-4H-pyrazole-3-carboxylic acid.
| Compound Name | 1-[3-(2,2-dicyanoethenylamino)phenyl]-5-oxo-4H-pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 168544113 |
| Molecular Formula | C14H9N5O3 |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 1-[3-(2,2-dicyanoethenylamino)phenyl]-5-oxo-4H-pyrazole-3-carboxylic acid |
| SMILES | N#CC(C#N)=CNc1cccc(N2N=C(C(=O)O)CC2=O)c1 |
| InChI | InChI=1S/C14H9N5O3/c15-6-9(7-16)8-17-10-2-1-3-11(4-10)19-13(20)5-12(18-19)14(21)22/h1-4,8,17H,5H2,(H,21,22) |
| InChIKey | XZURTFZYDUWROH-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 129.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_5_A(7)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|