C17H15N3O5S — CID 169372239
1-[3-[(4-methylphenyl)sulfonylamino]phenyl]-5-oxo-4H-pyrazole-3-carboxylic acid (PubChem CID 169372239) has the molecular formula C17H15N3O5S and a molecular weight of 373.39 g/mol. Its IUPAC name is 1-[3-[(4-methylphenyl)sulfonylamino]phenyl]-5-oxo-4H-pyrazole-3-carboxylic acid.
| Compound Name | 1-[3-[(4-methylphenyl)sulfonylamino]phenyl]-5-oxo-4H-pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 169372239 |
| Molecular Formula | C17H15N3O5S |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 1-[3-[(4-methylphenyl)sulfonylamino]phenyl]-5-oxo-4H-pyrazole-3-carboxylic acid |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cccc(N3N=C(C(=O)O)CC3=O)c2)cc1 |
| InChI | InChI=1S/C17H15N3O5S/c1-11-5-7-14(8-6-11)26(24,25)19-12-3-2-4-13(9-12)20-16(21)10-15(18-20)17(22)23/h2-9,19H,10H2,1H3,(H,22,23) |
| InChIKey | JUITYKCUMVASGT-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 116.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_5_A(7)', 'substructure': 'N/A'} |
|---|