C21H17N5O4S — CID 175905249
3-[1-[3-[(4-methylphenyl)sulfonylamino]phenyl]triazol-4-yl]pyridine-4-carboxylic acid (PubChem CID 175905249) has the molecular formula C21H17N5O4S and a molecular weight of 435.47 g/mol. Its IUPAC name is 3-[1-[3-[(4-methylphenyl)sulfonylamino]phenyl]triazol-4-yl]pyridine-4-carboxylic acid.
| Compound Name | 3-[1-[3-[(4-methylphenyl)sulfonylamino]phenyl]triazol-4-yl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 175905249 |
| Molecular Formula | C21H17N5O4S |
| Molecular Weight | 435.47 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 3-[1-[3-[(4-methylphenyl)sulfonylamino]phenyl]triazol-4-yl]pyridine-4-carboxylic acid |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cccc(-n3cc(-c4cnccc4C(=O)O)nn3)c2)cc1 |
| InChI | InChI=1S/C21H17N5O4S/c1-14-5-7-17(8-6-14)31(29,30)24-15-3-2-4-16(11-15)26-13-20(23-25-26)19-12-22-10-9-18(19)21(27)28/h2-13,24H,1H3,(H,27,28) |
| InChIKey | YITLNZZTCXCIMQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 127.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.47 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |