C16H12N4O3S — CID 168544163
4-anilino-3-(2,2-dicyanoethenylamino)benzenesulfonic acid (PubChem CID 168544163) has the molecular formula C16H12N4O3S and a molecular weight of 340.36 g/mol. Its IUPAC name is 4-anilino-3-(2,2-dicyanoethenylamino)benzenesulfonic acid.
| Compound Name | 4-anilino-3-(2,2-dicyanoethenylamino)benzenesulfonic acid |
|---|---|
| PubChem CID | 168544163 |
| Molecular Formula | C16H12N4O3S |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 4-anilino-3-(2,2-dicyanoethenylamino)benzenesulfonic acid |
| SMILES | N#CC(C#N)=CNc1cc(S(=O)(=O)O)ccc1Nc1ccccc1 |
| InChI | InChI=1S/C16H12N4O3S/c17-9-12(10-18)11-19-16-8-14(24(21,22)23)6-7-15(16)20-13-4-2-1-3-5-13/h1-8,11,19-20H,(H,21,22,23) |
| InChIKey | HEKWNYJZFNVMEK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 126.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|