C17H11BrN4O — CID 168543965
N-[2-bromo-4-(2,2-dicyanoethenylamino)phenyl]benzamide (PubChem CID 168543965) has the molecular formula C17H11BrN4O and a molecular weight of 367.21 g/mol. Its IUPAC name is N-[2-bromo-4-(2,2-dicyanoethenylamino)phenyl]benzamide.
| Compound Name | N-[2-bromo-4-(2,2-dicyanoethenylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 168543965 |
| Molecular Formula | C17H11BrN4O |
| Molecular Weight | 367.21 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | N-[2-bromo-4-(2,2-dicyanoethenylamino)phenyl]benzamide |
| SMILES | N#CC(C#N)=CNc1ccc(NC(=O)c2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C17H11BrN4O/c18-15-8-14(21-11-12(9-19)10-20)6-7-16(15)22-17(23)13-4-2-1-3-5-13/h1-8,11,21H,(H,22,23) |
| InChIKey | APXZTTLQFNWBLA-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.21 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|