C20H20N4O4 — CID 168547373
tert-butyl 4-(3-amino-4-cyano-2-methoxycarbonylpyrrol-1-yl)indole-1-carboxylate (PubChem CID 168547373) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is tert-butyl 4-(3-amino-4-cyano-2-methoxycarbonylpyrrol-1-yl)indole-1-carboxylate.
| Compound Name | tert-butyl 4-(3-amino-4-cyano-2-methoxycarbonylpyrrol-1-yl)indole-1-carboxylate |
|---|---|
| PubChem CID | 168547373 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | tert-butyl 4-(3-amino-4-cyano-2-methoxycarbonylpyrrol-1-yl)indole-1-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1cccc2c1ccn2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H20N4O4/c1-20(2,3)28-19(26)23-9-8-13-14(23)6-5-7-15(13)24-11-12(10-21)16(22)17(24)18(25)27-4/h5-9,11H,22H2,1-4H3 |
| InChIKey | QPDOFSRBCSWMMR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 112.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |