About methyl 3-amino-4-cyano-1-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]pyrrole-2-carboxylate
methyl 3-amino-4-cyano-1-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]pyrrole-2-carboxylate (PubChem CID 168548714) has the molecular formula C19H18N6O4S
and a molecular weight of 426.46 g/mol. Its IUPAC name is methyl 3-amino-4-cyano-1-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | methyl 3-amino-4-cyano-1-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]pyrrole-2-carboxylate |
| PubChem CID | 168548714 |
| Molecular Formula | C19H18N6O4S |
| Molecular Weight | 426.46 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | methyl 3-amino-4-cyano-1-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]pyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1ccc(S(=O)(=O)Nc2cc(C)nc(C)n2)cc1 |
| InChI | InChI=1S/C19H18N6O4S/c1-11-8-16(23-12(2)22-11)24-30(27,28)15-6-4-14(5-7-15)25-10-13(9-20)17(21)18(25)19(26)29-3/h4-8,10H,21H2,1-3H3,(H,22,23,24) |
| InChIKey | ASBWPWOANQHQOV-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 152.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.46 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze methyl 3-amino-4-cyano-1-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-amino-4-cyano-1-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]pyrrole-2-carboxylate?
The IUPAC name of methyl 3-amino-4-cyano-1-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]pyrrole-2-carboxylate (CID 168548714) is methyl 3-amino-4-cyano-1-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]pyrrole-2-carboxylate.
What is the SMILES notation for methyl 3-amino-4-cyano-1-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]pyrrole-2-carboxylate?
The canonical SMILES for methyl 3-amino-4-cyano-1-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]pyrrole-2-carboxylate is COC(=O)c1c(N)c(C#N)cn1-c1ccc(S(=O)(=O)Nc2cc(C)nc(C)n2)cc1.
What is the InChIKey of methyl 3-amino-4-cyano-1-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]pyrrole-2-carboxylate?
The InChIKey is ASBWPWOANQHQOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N6O4S/c1-11-8-16(23-12(2)22-11)24-30(27,28)15-6-4-14(5-7-15)25-10-13(9-20)17(21)18(25)19(26)29-3/h4-8,10H,21H2,1-3H3,(H,22,23,24).
What are the key properties of methyl 3-amino-4-cyano-1-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]pyrrole-2-carboxylate?
methyl 3-amino-4-cyano-1-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]pyrrole-2-carboxylate has a molecular weight of 426.46 g/mol, XLogP of 1.93, 5 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-amino-4-cyano-1-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]pyrrole-2-carboxylate is sourced from PubChem (CID 168548714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).