C24H23N3O3S — CID 168548760
methyl 1-[2-(5a,6,7,8,9,9a-hexahydro-4H-thieno[3,2-c]chromen-4-yl)phenyl]-3-amino-4-cyanopyrrole-2-carboxylate (PubChem CID 168548760) has the molecular formula C24H23N3O3S and a molecular weight of 433.53 g/mol. Its IUPAC name is methyl 1-[2-(5a,6,7,8,9,9a-hexahydro-4H-thieno[3,2-c]chromen-4-yl)phenyl]-3-amino-4-cyanopyrrole-2-carboxylate.
| Compound Name | methyl 1-[2-(5a,6,7,8,9,9a-hexahydro-4H-thieno[3,2-c]chromen-4-yl)phenyl]-3-amino-4-cyanopyrrole-2-carboxylate |
|---|---|
| PubChem CID | 168548760 |
| Molecular Formula | C24H23N3O3S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | methyl 1-[2-(5a,6,7,8,9,9a-hexahydro-4H-thieno[3,2-c]chromen-4-yl)phenyl]-3-amino-4-cyanopyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(N)c(C#N)cn1-c1ccccc1C1OC2CCCCC2c2sccc21 |
| InChI | InChI=1S/C24H23N3O3S/c1-29-24(28)21-20(26)14(12-25)13-27(21)18-8-4-2-6-15(18)22-17-10-11-31-23(17)16-7-3-5-9-19(16)30-22/h2,4,6,8,10-11,13,16,19,22H,3,5,7,9,26H2,1H3 |
| InChIKey | YAEGTJFYEDBRPZ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |