C17H10F6N2O2 — CID 168552135
2-[2-methoxy-4,6-bis(trifluoromethyl)phenyl]-3H-quinazolin-4-one (PubChem CID 168552135) has the molecular formula C17H10F6N2O2 and a molecular weight of 388.27 g/mol. Its IUPAC name is 2-[2-methoxy-4,6-bis(trifluoromethyl)phenyl]-3H-quinazolin-4-one.
| Compound Name | 2-[2-methoxy-4,6-bis(trifluoromethyl)phenyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 168552135 |
| Molecular Formula | C17H10F6N2O2 |
| Molecular Weight | 388.27 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 2-[2-methoxy-4,6-bis(trifluoromethyl)phenyl]-3H-quinazolin-4-one |
| SMILES | COc1cc(C(F)(F)F)cc(C(F)(F)F)c1-c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C17H10F6N2O2/c1-27-12-7-8(16(18,19)20)6-10(17(21,22)23)13(12)14-24-11-5-3-2-4-9(11)15(26)25-14/h2-7H,1H3,(H,24,25,26) |
| InChIKey | LCFGNMSBVMKLBY-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.27 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |