C27H25N3O6 — CID 168552483
ethyl 4-[[2-[2-ethoxy-4-(4-oxo-3H-quinazolin-2-yl)phenoxy]acetyl]amino]benzoate (PubChem CID 168552483) has the molecular formula C27H25N3O6 and a molecular weight of 487.51 g/mol. Its IUPAC name is ethyl 4-[[2-[2-ethoxy-4-(4-oxo-3H-quinazolin-2-yl)phenoxy]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[2-ethoxy-4-(4-oxo-3H-quinazolin-2-yl)phenoxy]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 168552483 |
| Molecular Formula | C27H25N3O6 |
| Molecular Weight | 487.51 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | ethyl 4-[[2-[2-ethoxy-4-(4-oxo-3H-quinazolin-2-yl)phenoxy]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)COc2ccc(-c3nc4ccccc4c(=O)[nH]3)cc2OCC)cc1 |
| InChI | InChI=1S/C27H25N3O6/c1-3-34-23-15-18(25-29-21-8-6-5-7-20(21)26(32)30-25)11-14-22(23)36-16-24(31)28-19-12-9-17(10-13-19)27(33)35-4-2/h5-15H,3-4,16H2,1-2H3,(H,28,31)(H,29,30,32) |
| InChIKey | XGNLHRHYEQKJJO-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.51 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |