C23H17ClN2O4 — CID 168552283
[2-ethoxy-4-(4-oxo-3H-quinazolin-2-yl)phenyl] 4-chlorobenzoate (PubChem CID 168552283) has the molecular formula C23H17ClN2O4 and a molecular weight of 420.85 g/mol. Its IUPAC name is [2-ethoxy-4-(4-oxo-3H-quinazolin-2-yl)phenyl] 4-chlorobenzoate.
| Compound Name | [2-ethoxy-4-(4-oxo-3H-quinazolin-2-yl)phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 168552283 |
| Molecular Formula | C23H17ClN2O4 |
| Molecular Weight | 420.85 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | [2-ethoxy-4-(4-oxo-3H-quinazolin-2-yl)phenyl] 4-chlorobenzoate |
| SMILES | CCOc1cc(-c2nc3ccccc3c(=O)[nH]2)ccc1OC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H17ClN2O4/c1-2-29-20-13-15(21-25-18-6-4-3-5-17(18)22(27)26-21)9-12-19(20)30-23(28)14-7-10-16(24)11-8-14/h3-13H,2H2,1H3,(H,25,26,27) |
| InChIKey | QDWJRCJUDGVBSQ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.85 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|