C22H19NO5 — CID 7763576
ethyl 4-[[2-(1-formylnaphthalen-2-yl)oxyacetyl]amino]benzoate (PubChem CID 7763576) has the molecular formula C22H19NO5 and a molecular weight of 377.40 g/mol. Its IUPAC name is ethyl 4-[[2-(1-formylnaphthalen-2-yl)oxyacetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-(1-formylnaphthalen-2-yl)oxyacetyl]amino]benzoate |
|---|---|
| PubChem CID | 7763576 |
| Molecular Formula | C22H19NO5 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | ethyl 4-[[2-(1-formylnaphthalen-2-yl)oxyacetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)COc2ccc3ccccc3c2C=O)cc1 |
| InChI | InChI=1S/C22H19NO5/c1-2-27-22(26)16-7-10-17(11-8-16)23-21(25)14-28-20-12-9-15-5-3-4-6-18(15)19(20)13-24/h3-13H,2,14H2,1H3,(H,23,25) |
| InChIKey | XHCOMFJBDTWCMF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|