C18H14FN3O6 — CID 168558264
3-[3-(4-fluorophenoxy)-5-nitroanilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione (PubChem CID 168558264) has the molecular formula C18H14FN3O6 and a molecular weight of 387.32 g/mol. Its IUPAC name is 3-[3-(4-fluorophenoxy)-5-nitroanilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione.
| Compound Name | 3-[3-(4-fluorophenoxy)-5-nitroanilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168558264 |
| Molecular Formula | C18H14FN3O6 |
| Molecular Weight | 387.32 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 3-[3-(4-fluorophenoxy)-5-nitroanilino]-1-(2-hydroxyethyl)pyrrole-2,5-dione |
| SMILES | O=C1C=C(Nc2cc(Oc3ccc(F)cc3)cc([N+](=O)[O-])c2)C(=O)N1CCO |
| InChI | InChI=1S/C18H14FN3O6/c19-11-1-3-14(4-2-11)28-15-8-12(7-13(9-15)22(26)27)20-16-10-17(24)21(5-6-23)18(16)25/h1-4,7-10,20,23H,5-6H2 |
| InChIKey | MWNFXOBABUEWDK-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 122.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|