C17H14N4O5S — CID 168559491
1-(2-hydroxyethyl)-3-(3-nitro-5-pyridin-2-ylsulfanylanilino)pyrrole-2,5-dione (PubChem CID 168559491) has the molecular formula C17H14N4O5S and a molecular weight of 386.39 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-(3-nitro-5-pyridin-2-ylsulfanylanilino)pyrrole-2,5-dione.
| Compound Name | 1-(2-hydroxyethyl)-3-(3-nitro-5-pyridin-2-ylsulfanylanilino)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168559491 |
| Molecular Formula | C17H14N4O5S |
| Molecular Weight | 386.39 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-(3-nitro-5-pyridin-2-ylsulfanylanilino)pyrrole-2,5-dione |
| SMILES | O=C1C=C(Nc2cc(Sc3ccccn3)cc([N+](=O)[O-])c2)C(=O)N1CCO |
| InChI | InChI=1S/C17H14N4O5S/c22-6-5-20-16(23)10-14(17(20)24)19-11-7-12(21(25)26)9-13(8-11)27-15-3-1-2-4-18-15/h1-4,7-10,19,22H,5-6H2 |
| InChIKey | CPDFRUNVTPARNR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 125.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.39 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|