C20H20N2O8S — CID 168563290
2-[[1-(2-hydroxyethyl)-3-methoxycarbonyl-5-oxo-2H-pyrrol-4-yl]amino]-5-(4-hydroxyphenyl)benzenesulfonic acid (PubChem CID 168563290) has the molecular formula C20H20N2O8S and a molecular weight of 448.45 g/mol. Its IUPAC name is 2-[[1-(2-hydroxyethyl)-3-methoxycarbonyl-5-oxo-2H-pyrrol-4-yl]amino]-5-(4-hydroxyphenyl)benzenesulfonic acid.
| Compound Name | 2-[[1-(2-hydroxyethyl)-3-methoxycarbonyl-5-oxo-2H-pyrrol-4-yl]amino]-5-(4-hydroxyphenyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 168563290 |
| Molecular Formula | C20H20N2O8S |
| Molecular Weight | 448.45 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | 2-[[1-(2-hydroxyethyl)-3-methoxycarbonyl-5-oxo-2H-pyrrol-4-yl]amino]-5-(4-hydroxyphenyl)benzenesulfonic acid |
| SMILES | COC(=O)C1=C(Nc2ccc(-c3ccc(O)cc3)cc2S(=O)(=O)O)C(=O)N(CCO)C1 |
| InChI | InChI=1S/C20H20N2O8S/c1-30-20(26)15-11-22(8-9-23)19(25)18(15)21-16-7-4-13(10-17(16)31(27,28)29)12-2-5-14(24)6-3-12/h2-7,10,21,23-24H,8-9,11H2,1H3,(H,27,28,29) |
| InChIKey | SFZWFFJEBKCQTF-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 153.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.45 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|