C18H15BrN4O4 — CID 168567808
dimethyl (E)-2-[[2-(5-bromo-3-pyridinyl)-3H-benzimidazol-5-yl]amino]but-2-enedioate (PubChem CID 168567808) has the molecular formula C18H15BrN4O4 and a molecular weight of 431.25 g/mol. Its IUPAC name is dimethyl (E)-2-[[2-(5-bromo-3-pyridinyl)-3H-benzimidazol-5-yl]amino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[[2-(5-bromo-3-pyridinyl)-3H-benzimidazol-5-yl]amino]but-2-enedioate |
|---|---|
| PubChem CID | 168567808 |
| Molecular Formula | C18H15BrN4O4 |
| Molecular Weight | 431.25 g/mol |
| Exact Mass | 430.03 |
| IUPAC Name | dimethyl (E)-2-[[2-(5-bromo-3-pyridinyl)-3H-benzimidazol-5-yl]amino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1ccc2nc(-c3cncc(Br)c3)[nH]c2c1)C(=O)OC |
| InChI | InChI=1S/C18H15BrN4O4/c1-26-16(24)7-15(18(25)27-2)21-12-3-4-13-14(6-12)23-17(22-13)10-5-11(19)9-20-8-10/h3-9,21H,1-2H3,(H,22,23)/b15-7+ |
| InChIKey | UMHXLCJIOHHPPR-VIZOYTHASA-N |
| XLogP | 3.03 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.25 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|