C29H19N5O3 — CID 168572861
[4-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate (PubChem CID 168572861) has the molecular formula C29H19N5O3 and a molecular weight of 485.50 g/mol. Its IUPAC name is [4-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate.
| Compound Name | [4-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 168572861 |
| Molecular Formula | C29H19N5O3 |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | [4-[[(5-cyano-6-oxo-4-phenyl-1H-pyrimidin-2-yl)hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate |
| SMILES | N#Cc1c(-c2ccccc2)nc(NN=Cc2ccc(OC(=O)c3cccc4ccccc34)cc2)[nH]c1=O |
| InChI | InChI=1S/C29H19N5O3/c30-17-25-26(21-8-2-1-3-9-21)32-29(33-27(25)35)34-31-18-19-13-15-22(16-14-19)37-28(36)24-12-6-10-20-7-4-5-11-23(20)24/h1-16,18H,(H2,32,33,34,35) |
| InChIKey | PZIXLJLZDIRJLS-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 120.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|