C12H7F4N3O3S — CID 168574712
2-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 168574712) has the molecular formula C12H7F4N3O3S and a molecular weight of 349.27 g/mol. Its IUPAC name is 2-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 168574712 |
| Molecular Formula | C12H7F4N3O3S |
| Molecular Weight | 349.27 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | 2-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(=NN=Cc2ccc3c(c2)OC(F)(F)C(F)(F)O3)N1 |
| InChI | InChI=1S/C12H7F4N3O3S/c13-11(14)12(15,16)22-8-3-6(1-2-7(8)21-11)4-17-19-10-18-9(20)5-23-10/h1-4H,5H2,(H,18,19,20) |
| InChIKey | IKXPANNLSYRPAU-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.27 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|