C19H26N4OS — CID 168576057
2-[[2,5-dimethyl-3-[(2-methylpiperidin-1-yl)methyl]phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 168576057) has the molecular formula C19H26N4OS and a molecular weight of 358.51 g/mol. Its IUPAC name is 2-[[2,5-dimethyl-3-[(2-methylpiperidin-1-yl)methyl]phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-[[2,5-dimethyl-3-[(2-methylpiperidin-1-yl)methyl]phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 168576057 |
| Molecular Formula | C19H26N4OS |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 2-[[2,5-dimethyl-3-[(2-methylpiperidin-1-yl)methyl]phenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(C=NN=C2NC(=O)CS2)c(C)c(CN2CCCCC2C)c1 |
| InChI | InChI=1S/C19H26N4OS/c1-13-8-16(10-20-22-19-21-18(24)12-25-19)15(3)17(9-13)11-23-7-5-4-6-14(23)2/h8-10,14H,4-7,11-12H2,1-3H3,(H,21,22,24) |
| InChIKey | BIRIWCFBLKBRTD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|