C15H14ClN5O2S — CID 168576662
2-[[3-[(4-chloropyrazol-1-yl)methyl]-4-methoxyphenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 168576662) has the molecular formula C15H14ClN5O2S and a molecular weight of 363.83 g/mol. Its IUPAC name is 2-[[3-[(4-chloropyrazol-1-yl)methyl]-4-methoxyphenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-[[3-[(4-chloropyrazol-1-yl)methyl]-4-methoxyphenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 168576662 |
| Molecular Formula | C15H14ClN5O2S |
| Molecular Weight | 363.83 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | 2-[[3-[(4-chloropyrazol-1-yl)methyl]-4-methoxyphenyl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(C=NN=C2NC(=O)CS2)cc1Cn1cc(Cl)cn1 |
| InChI | InChI=1S/C15H14ClN5O2S/c1-23-13-3-2-10(5-17-20-15-19-14(22)9-24-15)4-11(13)7-21-8-12(16)6-18-21/h2-6,8H,7,9H2,1H3,(H,19,20,22) |
| InChIKey | AXDBKKGSVLIMBH-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 80.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.83 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|