C19H14FN5S — CID 168577342
N-[(5-fluoro-2-pyrazol-1-ylphenyl)methylideneamino]-4-phenyl-1,3-thiazol-2-amine (PubChem CID 168577342) has the molecular formula C19H14FN5S and a molecular weight of 363.42 g/mol. Its IUPAC name is N-[(5-fluoro-2-pyrazol-1-ylphenyl)methylideneamino]-4-phenyl-1,3-thiazol-2-amine.
| Compound Name | N-[(5-fluoro-2-pyrazol-1-ylphenyl)methylideneamino]-4-phenyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168577342 |
| Molecular Formula | C19H14FN5S |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | N-[(5-fluoro-2-pyrazol-1-ylphenyl)methylideneamino]-4-phenyl-1,3-thiazol-2-amine |
| SMILES | Fc1ccc(-n2cccn2)c(C=NNc2nc(-c3ccccc3)cs2)c1 |
| InChI | InChI=1S/C19H14FN5S/c20-16-7-8-18(25-10-4-9-22-25)15(11-16)12-21-24-19-23-17(13-26-19)14-5-2-1-3-6-14/h1-13H,(H,23,24) |
| InChIKey | SLFGCWAMLXLEPS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|