C22H23BFN3O2S — CID 168578189
N-[[4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine (PubChem CID 168578189) has the molecular formula C22H23BFN3O2S and a molecular weight of 423.32 g/mol. Its IUPAC name is N-[[4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine.
| Compound Name | N-[[4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168578189 |
| Molecular Formula | C22H23BFN3O2S |
| Molecular Weight | 423.32 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | N-[[4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine |
| SMILES | CC1(C)OB(c2cc(F)ccc2C=NNc2nc(-c3ccccc3)cs2)OC1(C)C |
| InChI | InChI=1S/C22H23BFN3O2S/c1-21(2)22(3,4)29-23(28-21)18-12-17(24)11-10-16(18)13-25-27-20-26-19(14-30-20)15-8-6-5-7-9-15/h5-14H,1-4H3,(H,26,27) |
| InChIKey | MSSBIAVSTQAVIQ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 55.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.32 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|