C26H26N4O2S2 — CID 168578607
4-tert-butyl-N-[3-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]benzenesulfonamide (PubChem CID 168578607) has the molecular formula C26H26N4O2S2 and a molecular weight of 490.65 g/mol. Its IUPAC name is 4-tert-butyl-N-[3-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[3-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 168578607 |
| Molecular Formula | C26H26N4O2S2 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | 4-tert-butyl-N-[3-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]benzenesulfonamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)Nc2cccc(C=NNc3nc(-c4ccccc4)cs3)c2)cc1 |
| InChI | InChI=1S/C26H26N4O2S2/c1-26(2,3)21-12-14-23(15-13-21)34(31,32)30-22-11-7-8-19(16-22)17-27-29-25-28-24(18-33-25)20-9-5-4-6-10-20/h4-18,30H,1-3H3,(H,28,29) |
| InChIKey | KVQLXDMLRPWTGV-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|