C18H22N4O2S2 — CID 168535590
[[3-[(4-tert-butylphenyl)sulfonylamino]phenyl]methylideneamino]thiourea (PubChem CID 168535590) has the molecular formula C18H22N4O2S2 and a molecular weight of 390.53 g/mol. Its IUPAC name is [[3-[(4-tert-butylphenyl)sulfonylamino]phenyl]methylideneamino]thiourea.
| Compound Name | [[3-[(4-tert-butylphenyl)sulfonylamino]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 168535590 |
| Molecular Formula | C18H22N4O2S2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | [[3-[(4-tert-butylphenyl)sulfonylamino]phenyl]methylideneamino]thiourea |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)Nc2cccc(C=NNC(N)=S)c2)cc1 |
| InChI | InChI=1S/C18H22N4O2S2/c1-18(2,3)14-7-9-16(10-8-14)26(23,24)22-15-6-4-5-13(11-15)12-20-21-17(19)25/h4-12,22H,1-3H3,(H3,19,21,25) |
| InChIKey | CSMPDXDOXUQWQD-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|