C23H23N5O3S — CID 168578658
3-[[2-methoxy-5-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]methyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 168578658) has the molecular formula C23H23N5O3S and a molecular weight of 449.54 g/mol. Its IUPAC name is 3-[[2-methoxy-5-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]methyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[[2-methoxy-5-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]methyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 168578658 |
| Molecular Formula | C23H23N5O3S |
| Molecular Weight | 449.54 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | 3-[[2-methoxy-5-[[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]methyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | COc1ccc(C=NNc2nc(-c3ccccc3)cs2)cc1CN1C(=O)NC(C)(C)C1=O |
| InChI | InChI=1S/C23H23N5O3S/c1-23(2)20(29)28(22(30)26-23)13-17-11-15(9-10-19(17)31-3)12-24-27-21-25-18(14-32-21)16-7-5-4-6-8-16/h4-12,14H,13H2,1-3H3,(H,25,27)(H,26,30) |
| InChIKey | QCVNJCAOTHPVCN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.54 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|