C26H23N5O2S2 — CID 168578663
N-[[4-methoxy-3-[(6-methoxy-1H-benzimidazol-2-yl)sulfanylmethyl]phenyl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine (PubChem CID 168578663) has the molecular formula C26H23N5O2S2 and a molecular weight of 501.64 g/mol. Its IUPAC name is N-[[4-methoxy-3-[(6-methoxy-1H-benzimidazol-2-yl)sulfanylmethyl]phenyl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine.
| Compound Name | N-[[4-methoxy-3-[(6-methoxy-1H-benzimidazol-2-yl)sulfanylmethyl]phenyl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168578663 |
| Molecular Formula | C26H23N5O2S2 |
| Molecular Weight | 501.64 g/mol |
| Exact Mass | 501.13 |
| IUPAC Name | N-[[4-methoxy-3-[(6-methoxy-1H-benzimidazol-2-yl)sulfanylmethyl]phenyl]methylideneamino]-4-phenyl-1,3-thiazol-2-amine |
| SMILES | COc1ccc2nc(SCc3cc(C=NNc4nc(-c5ccccc5)cs4)ccc3OC)[nH]c2c1 |
| InChI | InChI=1S/C26H23N5O2S2/c1-32-20-9-10-21-22(13-20)29-25(28-21)34-15-19-12-17(8-11-24(19)33-2)14-27-31-26-30-23(16-35-26)18-6-4-3-5-7-18/h3-14,16H,15H2,1-2H3,(H,28,29)(H,30,31) |
| InChIKey | DIABVNPOQNEFCZ-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.64 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|