C18H20N6O2S — CID 168592282
2-[[4-methoxy-3-[(6-methoxy-1H-benzimidazol-2-yl)sulfanylmethyl]phenyl]methylideneamino]guanidine (PubChem CID 168592282) has the molecular formula C18H20N6O2S and a molecular weight of 384.47 g/mol. Its IUPAC name is 2-[[4-methoxy-3-[(6-methoxy-1H-benzimidazol-2-yl)sulfanylmethyl]phenyl]methylideneamino]guanidine.
| Compound Name | 2-[[4-methoxy-3-[(6-methoxy-1H-benzimidazol-2-yl)sulfanylmethyl]phenyl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 168592282 |
| Molecular Formula | C18H20N6O2S |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 2-[[4-methoxy-3-[(6-methoxy-1H-benzimidazol-2-yl)sulfanylmethyl]phenyl]methylideneamino]guanidine |
| SMILES | COc1ccc2nc(SCc3cc(C=NN=C(N)N)ccc3OC)[nH]c2c1 |
| InChI | InChI=1S/C18H20N6O2S/c1-25-13-4-5-14-15(8-13)23-18(22-14)27-10-12-7-11(3-6-16(12)26-2)9-21-24-17(19)20/h3-9H,10H2,1-2H3,(H,22,23)(H4,19,20,24) |
| InChIKey | AYWKWMCWJLDWCM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 123.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|