C17H11BrN2O2 — CID 168586021
4-(6-bromo-2-hydroxynaphthalen-1-yl)-6-methyl-2-oxo-1H-pyridine-3-carbonitrile (PubChem CID 168586021) has the molecular formula C17H11BrN2O2 and a molecular weight of 355.19 g/mol. Its IUPAC name is 4-(6-bromo-2-hydroxynaphthalen-1-yl)-6-methyl-2-oxo-1H-pyridine-3-carbonitrile.
| Compound Name | 4-(6-bromo-2-hydroxynaphthalen-1-yl)-6-methyl-2-oxo-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 168586021 |
| Molecular Formula | C17H11BrN2O2 |
| Molecular Weight | 355.19 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | 4-(6-bromo-2-hydroxynaphthalen-1-yl)-6-methyl-2-oxo-1H-pyridine-3-carbonitrile |
| SMILES | Cc1cc(-c2c(O)ccc3cc(Br)ccc23)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C17H11BrN2O2/c1-9-6-13(14(8-19)17(22)20-9)16-12-4-3-11(18)7-10(12)2-5-15(16)21/h2-7,21H,1H3,(H,20,22) |
| InChIKey | AOQIHMUEAGJSKP-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.19 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |