C19H20N2OS — CID 168586224
4-(4-cyclohexylsulfanylphenyl)-6-methyl-2-oxo-1H-pyridine-3-carbonitrile (PubChem CID 168586224) has the molecular formula C19H20N2OS and a molecular weight of 324.45 g/mol. Its IUPAC name is 4-(4-cyclohexylsulfanylphenyl)-6-methyl-2-oxo-1H-pyridine-3-carbonitrile.
| Compound Name | 4-(4-cyclohexylsulfanylphenyl)-6-methyl-2-oxo-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 168586224 |
| Molecular Formula | C19H20N2OS |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 4-(4-cyclohexylsulfanylphenyl)-6-methyl-2-oxo-1H-pyridine-3-carbonitrile |
| SMILES | Cc1cc(-c2ccc(SC3CCCCC3)cc2)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C19H20N2OS/c1-13-11-17(18(12-20)19(22)21-13)14-7-9-16(10-8-14)23-15-5-3-2-4-6-15/h7-11,15H,2-6H2,1H3,(H,21,22) |
| InChIKey | YDLVAWFJQGPQBC-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |