C23H28N4O4S — CID 168588579
tert-butyl 4-[[4-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)phenyl]methoxy]piperidine-1-carboxylate (PubChem CID 168588579) has the molecular formula C23H28N4O4S and a molecular weight of 456.57 g/mol. Its IUPAC name is tert-butyl 4-[[4-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)phenyl]methoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)phenyl]methoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 168588579 |
| Molecular Formula | C23H28N4O4S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | tert-butyl 4-[[4-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)phenyl]methoxy]piperidine-1-carboxylate |
| SMILES | CSc1nc(-c2ccc(COC3CCN(C(=O)OC(C)(C)C)CC3)cc2)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C23H28N4O4S/c1-23(2,3)31-22(29)27-11-9-17(10-12-27)30-14-15-5-7-16(8-6-15)19-18(13-24)20(28)26-21(25-19)32-4/h5-8,17H,9-12,14H2,1-4H3,(H,25,26,28) |
| InChIKey | SMWJADZOMKNAGL-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|