C11H14N4O3 — CID 168591032
2-[4-[(diaminomethylidenehydrazinylidene)methyl]phenoxy]propanoic acid (PubChem CID 168591032) has the molecular formula C11H14N4O3 and a molecular weight of 250.26 g/mol. Its IUPAC name is 2-[4-[(diaminomethylidenehydrazinylidene)methyl]phenoxy]propanoic acid.
| Compound Name | 2-[4-[(diaminomethylidenehydrazinylidene)methyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 168591032 |
| Molecular Formula | C11H14N4O3 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 2-[4-[(diaminomethylidenehydrazinylidene)methyl]phenoxy]propanoic acid |
| SMILES | CC(Oc1ccc(C=NN=C(N)N)cc1)C(=O)O |
| InChI | InChI=1S/C11H14N4O3/c1-7(10(16)17)18-9-4-2-8(3-5-9)6-14-15-11(12)13/h2-7H,1H3,(H,16,17)(H4,12,13,15) |
| InChIKey | XBZQJOWXOGUIAR-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 123.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|