C21H23N5O2S — CID 16859136
N-cyclohexyl-2-(2-oxo-6-phenyl-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)acetamide (PubChem CID 16859136) has the molecular formula C21H23N5O2S and a molecular weight of 409.52 g/mol. Its IUPAC name is N-cyclohexyl-2-(2-oxo-6-phenyl-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)acetamide.
| Compound Name | N-cyclohexyl-2-(2-oxo-6-phenyl-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)acetamide |
|---|---|
| PubChem CID | 16859136 |
| Molecular Formula | C21H23N5O2S |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | N-cyclohexyl-2-(2-oxo-6-phenyl-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)acetamide |
| SMILES | O=C(CC1CSc2nc3c(cnn3-c3ccccc3)c(=O)n21)NC1CCCCC1 |
| InChI | InChI=1S/C21H23N5O2S/c27-18(23-14-7-3-1-4-8-14)11-16-13-29-21-24-19-17(20(28)25(16)21)12-22-26(19)15-9-5-2-6-10-15/h2,5-6,9-10,12,14,16H,1,3-4,7-8,11,13H2,(H,23,27) |
| InChIKey | XOQPGSUHJIFPJG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |