C23H21N5O2S — CID 16859212
N-(2,5-dimethylphenyl)-2-(2-oxo-6-phenyl-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)acetamide (PubChem CID 16859212) has the molecular formula C23H21N5O2S and a molecular weight of 431.52 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-2-(2-oxo-6-phenyl-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)acetamide.
| Compound Name | N-(2,5-dimethylphenyl)-2-(2-oxo-6-phenyl-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)acetamide |
|---|---|
| PubChem CID | 16859212 |
| Molecular Formula | C23H21N5O2S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | N-(2,5-dimethylphenyl)-2-(2-oxo-6-phenyl-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)acetamide |
| SMILES | Cc1ccc(C)c(NC(=O)CC2CSc3nc4c(cnn4-c4ccccc4)c(=O)n32)c1 |
| InChI | InChI=1S/C23H21N5O2S/c1-14-8-9-15(2)19(10-14)25-20(29)11-17-13-31-23-26-21-18(22(30)27(17)23)12-24-28(21)16-6-4-3-5-7-16/h3-10,12,17H,11,13H2,1-2H3,(H,25,29) |
| InChIKey | WZLOBTWWBJDUTG-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |