C23H19N5O4S — CID 16859197
methyl 2-[[2-(2-oxo-6-phenyl-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)acetyl]amino]benzoate (PubChem CID 16859197) has the molecular formula C23H19N5O4S and a molecular weight of 461.50 g/mol. Its IUPAC name is methyl 2-[[2-(2-oxo-6-phenyl-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)acetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-(2-oxo-6-phenyl-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 16859197 |
| Molecular Formula | C23H19N5O4S |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | methyl 2-[[2-(2-oxo-6-phenyl-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)CC1CSc2nc3c(cnn3-c3ccccc3)c(=O)n21 |
| InChI | InChI=1S/C23H19N5O4S/c1-32-22(31)16-9-5-6-10-18(16)25-19(29)11-15-13-33-23-26-20-17(21(30)27(15)23)12-24-28(20)14-7-3-2-4-8-14/h2-10,12,15H,11,13H2,1H3,(H,25,29) |
| InChIKey | IXYJSZNDIGAECM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 108.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |