C22H18ClN5O3S — CID 16859856
2-[6-(3-chlorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(2-methoxyphenyl)acetamide (PubChem CID 16859856) has the molecular formula C22H18ClN5O3S and a molecular weight of 467.94 g/mol. Its IUPAC name is 2-[6-(3-chlorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[6-(3-chlorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 16859856 |
| Molecular Formula | C22H18ClN5O3S |
| Molecular Weight | 467.94 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | 2-[6-(3-chlorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)CC1CSc2nc3c(cnn3-c3cccc(Cl)c3)c(=O)n21 |
| InChI | InChI=1S/C22H18ClN5O3S/c1-31-18-8-3-2-7-17(18)25-19(29)10-15-12-32-22-26-20-16(21(30)27(15)22)11-24-28(20)14-6-4-5-13(23)9-14/h2-9,11,15H,10,12H2,1H3,(H,25,29) |
| InChIKey | IFGYBWSFLQHHHZ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 91.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.94 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |