C19H15ClN6O2S2 — CID 16859921
2-[6-(3-chlorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(4-methyl-1,3-thiazol-2-yl)acetamide (PubChem CID 16859921) has the molecular formula C19H15ClN6O2S2 and a molecular weight of 458.96 g/mol. Its IUPAC name is 2-[6-(3-chlorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(4-methyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[6-(3-chlorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(4-methyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 16859921 |
| Molecular Formula | C19H15ClN6O2S2 |
| Molecular Weight | 458.96 g/mol |
| Exact Mass | 458.04 |
| IUPAC Name | 2-[6-(3-chlorophenyl)-2-oxo-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl]-N-(4-methyl-1,3-thiazol-2-yl)acetamide |
| SMILES | Cc1csc(NC(=O)CC2CSc3nc4c(cnn4-c4cccc(Cl)c4)c(=O)n32)n1 |
| InChI | InChI=1S/C19H15ClN6O2S2/c1-10-8-29-18(22-10)23-15(27)6-13-9-30-19-24-16-14(17(28)25(13)19)7-21-26(16)12-4-2-3-11(20)5-12/h2-5,7-8,13H,6,9H2,1H3,(H,22,23,27) |
| InChIKey | OEMDODXBCFLYMY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 94.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.96 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |