C22H24ClN5O2S — CID 16859748
6-(3-chlorophenyl)-12-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl]-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one (PubChem CID 16859748) has the molecular formula C22H24ClN5O2S and a molecular weight of 457.99 g/mol. Its IUPAC name is 6-(3-chlorophenyl)-12-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl]-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one.
| Compound Name | 6-(3-chlorophenyl)-12-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl]-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one |
|---|---|
| PubChem CID | 16859748 |
| Molecular Formula | C22H24ClN5O2S |
| Molecular Weight | 457.99 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | 6-(3-chlorophenyl)-12-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl]-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one |
| SMILES | CC1CCCC(C)N1C(=O)CC1CSc2nc3c(cnn3-c3cccc(Cl)c3)c(=O)n21 |
| InChI | InChI=1S/C22H24ClN5O2S/c1-13-5-3-6-14(2)26(13)19(29)10-17-12-31-22-25-20-18(21(30)27(17)22)11-24-28(20)16-8-4-7-15(23)9-16/h4,7-9,11,13-14,17H,3,5-6,10,12H2,1-2H3 |
| InChIKey | NOKVCZBFWJKSJF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 73.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.99 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |