C25H23ClN6O2S — CID 16859767
6-(3-chlorophenyl)-12-[2-oxo-2-(2-pyridin-3-ylpiperidin-1-yl)ethyl]-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one (PubChem CID 16859767) has the molecular formula C25H23ClN6O2S and a molecular weight of 507.02 g/mol. Its IUPAC name is 6-(3-chlorophenyl)-12-[2-oxo-2-(2-pyridin-3-ylpiperidin-1-yl)ethyl]-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one.
| Compound Name | 6-(3-chlorophenyl)-12-[2-oxo-2-(2-pyridin-3-ylpiperidin-1-yl)ethyl]-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one |
|---|---|
| PubChem CID | 16859767 |
| Molecular Formula | C25H23ClN6O2S |
| Molecular Weight | 507.02 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | 6-(3-chlorophenyl)-12-[2-oxo-2-(2-pyridin-3-ylpiperidin-1-yl)ethyl]-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one |
| SMILES | O=C(CC1CSc2nc3c(cnn3-c3cccc(Cl)c3)c(=O)n21)N1CCCCC1c1cccnc1 |
| InChI | InChI=1S/C25H23ClN6O2S/c26-17-6-3-7-18(11-17)32-23-20(14-28-32)24(34)31-19(15-35-25(31)29-23)12-22(33)30-10-2-1-8-21(30)16-5-4-9-27-13-16/h3-7,9,11,13-14,19,21H,1-2,8,10,12,15H2 |
| InChIKey | UTBOXTYNQOFNNL-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 85.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.02 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |