C26H25ClN6O3S — CID 16859762
6-(3-chlorophenyl)-12-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one (PubChem CID 16859762) has the molecular formula C26H25ClN6O3S and a molecular weight of 537.05 g/mol. Its IUPAC name is 6-(3-chlorophenyl)-12-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one.
| Compound Name | 6-(3-chlorophenyl)-12-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one |
|---|---|
| PubChem CID | 16859762 |
| Molecular Formula | C26H25ClN6O3S |
| Molecular Weight | 537.05 g/mol |
| Exact Mass | 536.14 |
| IUPAC Name | 6-(3-chlorophenyl)-12-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one |
| SMILES | COc1ccccc1N1CCN(C(=O)CC2CSc3nc4c(cnn4-c4cccc(Cl)c4)c(=O)n32)CC1 |
| InChI | InChI=1S/C26H25ClN6O3S/c1-36-22-8-3-2-7-21(22)30-9-11-31(12-10-30)23(34)14-19-16-37-26-29-24-20(25(35)32(19)26)15-28-33(24)18-6-4-5-17(27)13-18/h2-8,13,15,19H,9-12,14,16H2,1H3 |
| InChIKey | DNBFVAPMAQNKHF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 85.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.05 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |