C22H23N5O4S — CID 16859096
methyl 1-[2-(2-oxo-6-phenyl-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)acetyl]piperidine-4-carboxylate (PubChem CID 16859096) has the molecular formula C22H23N5O4S and a molecular weight of 453.52 g/mol. Its IUPAC name is methyl 1-[2-(2-oxo-6-phenyl-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)acetyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[2-(2-oxo-6-phenyl-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)acetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 16859096 |
| Molecular Formula | C22H23N5O4S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | methyl 1-[2-(2-oxo-6-phenyl-10-thia-1,5,6,8-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-12-yl)acetyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)CC2CSc3nc4c(cnn4-c4ccccc4)c(=O)n32)CC1 |
| InChI | InChI=1S/C22H23N5O4S/c1-31-21(30)14-7-9-25(10-8-14)18(28)11-16-13-32-22-24-19-17(20(29)26(16)22)12-23-27(19)15-5-3-2-4-6-15/h2-6,12,14,16H,7-11,13H2,1H3 |
| InChIKey | BEEDLQHTVFZODK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 99.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |